cas: 6842-62-2 — see every product listed under this CAS number, including other names
1-Chloro-3-(4-chlorophenoxy)benzene (CAS 6842-62-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077639-25G |
| cas | 6842-62-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 50g | 159.34 Pln | |
| Fluorochem | 100g | 164.54 Pln | |
| Fluorochem | 500g | 440.49 Pln |
| delivery time | 3-4 weeks |
|---|
1-chloro-3-(4-chlorophenoxy)benzene (CAS 6842-62-2) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 1-chloro-3-(4-chlorophenoxy)benzene. InChIKey: HPRGYUWRGCTBAV-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 1-chloro-3-(4-chlorophenoxy)benzene |
| InChIKey | HPRGYUWRGCTBAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)