CAS 6842-62-2 appears in our catalog under these names: 3,4'-Dichlorodiphenyl ether, 97%, 3,4'-Dichlorodiphenyl Ether, 1-Chloro-3-(4-chlorophenoxy)benzene, 98%, 98%, 1-Chloro-3-(4-chlorophenoxy)benzene. Offered by: Combi-blocks, AmBeed, Mikromol, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 100mg, 200g, 50g, 300g.
1-chloro-3-(4-chlorophenoxy)benzene (CAS 6842-62-2) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 1-chloro-3-(4-chlorophenoxy)benzene. InChIKey: HPRGYUWRGCTBAV-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 1-chloro-3-(4-chlorophenoxy)benzene |
| InChIKey | HPRGYUWRGCTBAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)