CAS 53714-66-2 appears in our catalog under these names: 2',3'-Dichloro-(1,1'-biphenyl)-4-ol, 95%, 4-(2,3-Dichlorophenyl)phenol, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(2,3-dichlorophenyl)phenol (CAS 53714-66-2) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)phenol. InChIKey: UTOHHFUBWXQVRN-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)phenol |
| InChIKey | UTOHHFUBWXQVRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)