Products 4291-32-1
CAS 4291-32-1 is the registry number for 4-(3,5-Dichlorophenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(3,5-dichlorophenyl)phenol (CAS 4291-32-1) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 4-(3,5-dichlorophenyl)phenol. InChIKey: ADCBBGOITOQLRF-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 4-(3,5-dichlorophenyl)phenol |
| InChIKey | ADCBBGOITOQLRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
p-(3,5-Dichlorophenyl)phenol, Phenol, p-(3,5-dichlorophenyl)-, 4-(3,5-dichlorophenyl)phenol, 3',5'-Dichloro-[1,1'-biphenyl]-4-ol, 3,5-Dichloro-4'-hydroxybiphenyl, [1,1'-Biphenyl]-4-ol, 3',5'-dichloro-, ADCBBGOITOQLRF-UHFFFAOYSA-N, 1,1'-Biphenyl-4-ol, 3',5'-dichloro, 3',5'-Dichloro[1,1'-biphenyl]-4-ol