cas: 6842-62-2 — see every product listed under this CAS number, including other names
1-Chloro-3-(4-chlorophenoxy)benzene, 98%, 98% (CAS 6842-62-2) is a chemical reagent available from Chemat. Available pack sizes: 200g, 25g, 50g, 100g, 300g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140GC-200g |
| cas | 6842-62-2 |
| size | 200g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200g | 179.60 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 112.40 Pln | |
| Chemat | 100g | 126.80 Pln | |
| Chemat | 300g | 242.00 Pln | |
| Chemat | 500g | 379.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-chloro-3-(4-chlorophenoxy)benzene (CAS 6842-62-2) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 1-chloro-3-(4-chlorophenoxy)benzene. InChIKey: HPRGYUWRGCTBAV-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 1-chloro-3-(4-chlorophenoxy)benzene |
| InChIKey | HPRGYUWRGCTBAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)