CAS 53890-76-9 appears in our catalog under these names: 4-(2,4-Dichlorophenyl)phenol, 98%, 2',4'-Dichloro-(1,1'-biphenyl)-4-ol, 98%, 4-(2,4-Dichlorophenyl)phenol, ≥95%, ≥95%, 2',4'-Dichloro-[1,1'-biphenyl]-4-ol. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
4-(2,4-dichlorophenyl)phenol (CAS 53890-76-9) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)phenol. InChIKey: HKUPUWFUWPODDR-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)phenol |
| InChIKey | HKUPUWFUWPODDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)