1-Chloro-6-phenyldibenzo[b,d]furan, 98%
cas: 2244249-07-6 — see every product listed under this CAS number, including other names
1-Chloro-6-phenyldibenzo[b,d]furan, 98% (CAS 2244249-07-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1902973-250mg |
| cas | 2244249-07-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1126.88 Pln | |
| Ambeed | 10g | 1761.00 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 1208.49 Pln | |
| BLDpharm | 10g | 1897.13 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1019.60 Pln | |
| Chemat | 10g | 1590.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-chloro-6-phenyldibenzofuran (CAS 2244249-07-6) is a chemical compound with the molecular formula C18H11ClO and a molecular weight of 278.7 g/mol. IUPAC name: 1-chloro-6-phenyldibenzofuran. InChIKey: UBYYBQQLRRFNBN-UHFFFAOYSA-N.
| Molecular formula | C18H11ClO |
|---|---|
| Molecular weight | 278.7 g/mol |
| IUPAC name | 1-chloro-6-phenyldibenzofuran |
| InChIKey | UBYYBQQLRRFNBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2OC4=C3C(=CC=C4)Cl |
Computed by PubChem (NCBI)