Products 1267248-41-8
CAS 1267248-41-8 appears in our catalog under these names: 3–(4–Chlorophenyl)Dibenzo(b，d)Furan, 3-(4-Chlorophenyl)dibenzo[b,d]furan, 98%, 3-(4-Chlorophenyl)dibenzofuran, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 250mg, 1g.
3-(4-chlorophenyl)dibenzofuran (CAS 1267248-41-8) is a chemical compound with the molecular formula C18H11ClO and a molecular weight of 278.7 g/mol. IUPAC name: 3-(4-chlorophenyl)dibenzofuran. InChIKey: AMFCLAQSSMMYGU-UHFFFAOYSA-N.
| Molecular formula | C18H11ClO |
|---|---|
| Molecular weight | 278.7 g/mol |
| IUPAC name | 3-(4-chlorophenyl)dibenzofuran |
| InChIKey | AMFCLAQSSMMYGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)