CAS 2244249-07-6 appears in our catalog under these names: 1-Chloro-6-phenyldibenzo[b,d]furan, 98%, 98%, 1-Chloro-6-phenyldibenzo[b,d]furan, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
1-chloro-6-phenyldibenzofuran (CAS 2244249-07-6) is a chemical compound with the molecular formula C18H11ClO and a molecular weight of 278.7 g/mol. IUPAC name: 1-chloro-6-phenyldibenzofuran. InChIKey: UBYYBQQLRRFNBN-UHFFFAOYSA-N.
| Molecular formula | C18H11ClO |
|---|---|
| Molecular weight | 278.7 g/mol |
| IUPAC name | 1-chloro-6-phenyldibenzofuran |
| InChIKey | UBYYBQQLRRFNBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2OC4=C3C(=CC=C4)Cl |
Computed by PubChem (NCBI)