CAS 2379717-87-8 is the registry number for Dibenzofuran, 1-chloro-4-phenyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1-chloro-4-phenyldibenzofuran (CAS 2379717-87-8) is a chemical compound with the molecular formula C18H11ClO and a molecular weight of 278.7 g/mol. IUPAC name: 1-chloro-4-phenyldibenzofuran. InChIKey: NRYIDNWSKONILR-UHFFFAOYSA-N.
| Molecular formula | C18H11ClO |
|---|---|
| Molecular weight | 278.7 g/mol |
| IUPAC name | 1-chloro-4-phenyldibenzofuran |
| InChIKey | NRYIDNWSKONILR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C(=C(C=C2)Cl)C4=CC=CC=C4O3 |
Computed by PubChem (NCBI)