CAS 2101467-19-8 appears in our catalog under these names: 2-Chloro-4-phenyldibenzo[b,d]furan, 98%, 98%, 2-Chloro-4-phenyldibenzo[b,d]furan, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-4-phenyldibenzofuran (CAS 2101467-19-8) is a chemical compound with the molecular formula C18H11ClO and a molecular weight of 278.7 g/mol. IUPAC name: 2-chloro-4-phenyldibenzofuran. InChIKey: ULFVHXLMYKWTQJ-UHFFFAOYSA-N.
| Molecular formula | C18H11ClO |
|---|---|
| Molecular weight | 278.7 g/mol |
| IUPAC name | 2-chloro-4-phenyldibenzofuran |
| InChIKey | ULFVHXLMYKWTQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC3=C2OC4=CC=CC=C43)Cl |
Computed by PubChem (NCBI)