CAS 2148344-60-7 appears in our catalog under these names: 1-[2-[2-(4-Chlorophenyl)ethynyl]phenyl]-2,3-butadien-1-one, 97%, 97%, 1-[2-[2-(4-Chlorophenyl)ethynyl]phenyl]-2,3-butadien-1-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-[2-[2-(4-chlorophenyl)ethynyl]phenyl]buta-2,3-dien-1-one (CAS 2148344-60-7) is a chemical compound with the molecular formula C18H11ClO and a molecular weight of 278.7 g/mol. IUPAC name: 1-[2-[2-(4-chlorophenyl)ethynyl]phenyl]buta-2,3-dien-1-one. InChIKey: WVDOYPGKVHBOTP-UHFFFAOYSA-N.
| Molecular formula | C18H11ClO |
|---|---|
| Molecular weight | 278.7 g/mol |
| IUPAC name | 1-[2-[2-(4-chlorophenyl)ethynyl]phenyl]buta-2,3-dien-1-one |
| InChIKey | WVDOYPGKVHBOTP-UHFFFAOYSA-N |
| SMILES | C=C=CC(=O)C1=CC=CC=C1C#CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)