cas: 141091-37-4 — see every product listed under this CAS number, including other names
1-Cyclohexen-yl-boronic acid pinacol ester, 95% (CAS 141091-37-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078956-250MG |
| cas | 141091-37-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 81.24 Pln | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 1065.27 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 141091-37-4) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QNZFUMVTUFOLRT-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QNZFUMVTUFOLRT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCC2 |
Computed by PubChem (NCBI)