1-Cyclohexeneboronic acid pinacol ester, 99.65%
cas: 141091-37-4 — see every product listed under this CAS number, including other names
1-Cyclohexeneboronic acid pinacol ester, 99.65% (CAS 141091-37-4) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007746-10 g |
| cas | 141091-37-4 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 5 g | 240.74 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.65% |
2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 141091-37-4) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QNZFUMVTUFOLRT-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QNZFUMVTUFOLRT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCC2 |
Computed by PubChem (NCBI)
Synonyms:
2-(cyclohex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, Cyclohexene-1-boronic acid pinacol ester, 1-Cyclohexen-yl-boronic acid pinacol ester, 1-Cyclohexen-1-yl-boronic acid pinacol ester, 1-Cyclohexeneboronic Acid Pinacol Ester, 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, Cyclohexen-1-ylboronic acid, pinacol ester, 2-cyclohexenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(1-cyclohexenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, Cyclohexen-1-yl-boronic acid pinacol ester