cas: 141091-37-4 — see every product listed under this CAS number, including other names
1-Cyclohexenylboronic acid pinacol ester, 97% (CAS 141091-37-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500MG. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 430310010 |
| cas | 141091-37-4 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 1069.07 Pln | |
| Thermo Scientific (Acros) | 500MG | 623.62 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 141091-37-4) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QNZFUMVTUFOLRT-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QNZFUMVTUFOLRT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCC2 |
Computed by PubChem (NCBI)