CAS 15574-80-8 is the registry number for 1–Ethyl–2–methylquinolin–4(1H)–one. Offered by: GLPBio. Available pack sizes: 100mg.
1-ethyl-2-methylquinolin-4-one (CAS 15574-80-8) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 1-ethyl-2-methylquinolin-4-one. InChIKey: WZFJKLLNXNDXIP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1-ethyl-2-methylquinolin-4-one |
| InChIKey | WZFJKLLNXNDXIP-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=O)C2=CC=CC=C21)C |
Computed by PubChem (NCBI)