CAS 1198604-53-3 is the registry number for 3-Benzyl-3-azabicyclo[3.1.0]hexan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-benzyl-3-azabicyclo[3.1.0]hexan-2-one (CAS 1198604-53-3) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 3-benzyl-3-azabicyclo[3.1.0]hexan-2-one. InChIKey: ZSWYHQBTOWUEBA-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 3-benzyl-3-azabicyclo[3.1.0]hexan-2-one |
| InChIKey | ZSWYHQBTOWUEBA-UHFFFAOYSA-N |
| SMILES | C1C2C1C(=O)N(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)