1-Ethynyl-2-methoxy-4-nitrobenzene, 97%
cas: 1135283-10-1 — see every product listed under this CAS number, including other names
1-Ethynyl-2-methoxy-4-nitrobenzene, 97% (CAS 1135283-10-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A241421-100mg |
| cas | 1135283-10-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 2211.56 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2824.40 Pln | |
| BLDpharm | 100mg | 292.14 Pln | |
| BLDpharm | 250mg | 342.13 Pln | |
| BLDpharm | 1g | 642.02 Pln | |
| BLDpharm | 5g | 2380.30 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-ethynyl-2-methoxy-4-nitrobenzene (CAS 1135283-10-1) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 1-ethynyl-2-methoxy-4-nitrobenzene. InChIKey: IYZORHPOENKIKL-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-ethynyl-2-methoxy-4-nitrobenzene |
| InChIKey | IYZORHPOENKIKL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])C#C |
Computed by PubChem (NCBI)
