CAS 933738-38-6 is the registry number for 2-(Benzo[d]isoxazol-5-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(1,2-benzoxazol-5-yl)acetic acid (CAS 933738-38-6) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-(1,2-benzoxazol-5-yl)acetic acid. InChIKey: ULWWLMVBRAIXKX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-(1,2-benzoxazol-5-yl)acetic acid |
| InChIKey | ULWWLMVBRAIXKX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CC(=O)O)C=NO2 |
Computed by PubChem (NCBI)