CAS 935269-27-5 appears in our catalog under these names: 3-Oxoisoindoline-4-carboxylic acid, 96%, 3–Oxoisoindoline–4–carboxylic acid, 3-Oxo-2,3-dihydro-1H-isoindole-4-carboxylic acid, 3-Oxoisoindoline-4-carboxylic acid 97%, 3-Oxoisoindoline-4-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g, 500mg.
3-oxo-1,2-dihydroisoindole-4-carboxylic acid (CAS 935269-27-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 3-oxo-1,2-dihydroisoindole-4-carboxylic acid. InChIKey: SONYZPKBPBFLSS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-oxo-1,2-dihydroisoindole-4-carboxylic acid |
| InChIKey | SONYZPKBPBFLSS-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)