CAS 1466-88-2 appears in our catalog under these names: 2-PROPENAL, 3-(2-NITROPHENYL)-, 98%, 2–Nitrocinnamaldehyde, 2-Nitrocinnamaldehyde, 98%, 2-Nitrocinnamaldehyde, >98.0%(GC), 2-Nitrocinnamaldehyde, 98%, 98%. Offered by: Fluorochem, GLPBio, Combi-blocks, Ambeed, TCI. Available pack sizes: 1g, 5g, 100g, 25g, 50g.
(E)-3-(2-nitrophenyl)prop-2-enal (CAS 1466-88-2) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: (E)-3-(2-nitrophenyl)prop-2-enal. InChIKey: VMSMELHEXDVEDE-HWKANZROSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | (E)-3-(2-nitrophenyl)prop-2-enal |
| InChIKey | VMSMELHEXDVEDE-HWKANZROSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)