Products 59393-79-2

CAS 59393-79-2 is the registry number for 2-(Cyanomethoxy)benzoic acid, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(cyanomethoxy)benzoic acid (CAS 59393-79-2) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-(cyanomethoxy)benzoic acid. InChIKey: BGCVCJBIFBISFN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO3
Molecular weight177.16 g/mol
IUPAC name2-(cyanomethoxy)benzoic acid
InChIKeyBGCVCJBIFBISFN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)OCC#N

Computed by PubChem (NCBI)