Products 71217-46-4
CAS 71217-46-4 appears in our catalog under these names: 5-(Isocyanatomethyl)-1,3-benzodioxole, 95%, 5-(Isocyanatomethyl)-2H-1,3-benzodioxole, 95%, 5-(Isocyanatomethyl)-1,3-benzodioxole, 5-(Isocyanatomethyl)-1,3-benzodioxole, 97% . Offered by: Combi-blocks, AmBeed, Biosynth, Thermo Scientific. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
5-(isocyanatomethyl)-1,3-benzodioxole (CAS 71217-46-4) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 5-(isocyanatomethyl)-1,3-benzodioxole. InChIKey: RIUNOJGBBOBVDE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-(isocyanatomethyl)-1,3-benzodioxole |
| InChIKey | RIUNOJGBBOBVDE-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CN=C=O |
Computed by PubChem (NCBI)