cas: 1743-86-8 — see every product listed under this CAS number, including other names
1-Isothiocyanato-2-(trifluoromethyl)benzene 98% (CAS 1743-86-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A858920-250mg |
| cas | 1743-86-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 10g | 592.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A858920 |
1-isothiocyanato-2-(trifluoromethyl)benzene (CAS 1743-86-8) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 1-isothiocyanato-2-(trifluoromethyl)benzene. InChIKey: FCEKLQPJGXIQRY-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-isothiocyanato-2-(trifluoromethyl)benzene |
| InChIKey | FCEKLQPJGXIQRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)