cas: 1743-86-8 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)phenyl isothiocyanate, 98%, 98% (CAS 1743-86-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ZKP-250mg |
| cas | 1743-86-8 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 467.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-isothiocyanato-2-(trifluoromethyl)benzene (CAS 1743-86-8) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 1-isothiocyanato-2-(trifluoromethyl)benzene. InChIKey: FCEKLQPJGXIQRY-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-isothiocyanato-2-(trifluoromethyl)benzene |
| InChIKey | FCEKLQPJGXIQRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)