cas: 1743-86-8 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)phenyl isothiocyanate, 97% (CAS 1743-86-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | SB01593DE |
| cas | 1743-86-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 5g | 159.85 Pln | |
| Thermo Scientific | 10g | 285.59 Pln | |
| Thermo Scientific | 25g | 549.81 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-isothiocyanato-2-(trifluoromethyl)benzene (CAS 1743-86-8) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 1-isothiocyanato-2-(trifluoromethyl)benzene. InChIKey: FCEKLQPJGXIQRY-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-isothiocyanato-2-(trifluoromethyl)benzene |
| InChIKey | FCEKLQPJGXIQRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)