cas: 1803586-64-2 — see every product listed under this CAS number, including other names
1-Mesitylethanamine hydrochloride, 97% (CAS 1803586-64-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546768-100MG |
| cas | 1803586-64-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 1g | 2325.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride (CAS 1803586-64-2) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride. InChIKey: VFBGENMGPYITQS-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride |
| InChIKey | VFBGENMGPYITQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C)N)C.Cl |
Computed by PubChem (NCBI)