cas: 4900-63-4 — see every product listed under this CAS number, including other names
1-Methoxy-4-nitronaphthalene, 97%, 97% (CAS 4900-63-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DENH-1g |
| cas | 4900-63-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 314.00 Pln | |
| Chemat | 25g | 568.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-methoxy-4-nitronaphthalene (CAS 4900-63-4) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 1-methoxy-4-nitronaphthalene. InChIKey: YFJKGPRYPHFGQD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-methoxy-4-nitronaphthalene |
| InChIKey | YFJKGPRYPHFGQD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=CC=CC=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)