cas: 70692-45-4 — see every product listed under this CAS number, including other names
1-Methyl-2-nitro-4-(trifluoromethoxy)benzene 95+% (CAS 70692-45-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A256194-250mg |
| cas | 70692-45-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1232.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A256194 |
1-methyl-2-nitro-4-(trifluoromethoxy)benzene (CAS 70692-45-4) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 1-methyl-2-nitro-4-(trifluoromethoxy)benzene. InChIKey: QQIQNKQBMWNOQV-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 1-methyl-2-nitro-4-(trifluoromethoxy)benzene |
| InChIKey | QQIQNKQBMWNOQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)