cas: 139756-00-6 — see every product listed under this CAS number, including other names
1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid 95+% (CAS 139756-00-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A296125-10g |
| cas | 139756-00-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1872.25 Pln | |
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1193.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A296125 |
1-methyl-4-nitro-3-propylpyrazole-5-carboxylic acid (CAS 139756-00-6) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: 1-methyl-4-nitro-3-propylpyrazole-5-carboxylic acid. InChIKey: GFORSNBMYCLGIE-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 1-methyl-4-nitro-3-propylpyrazole-5-carboxylic acid |
| InChIKey | GFORSNBMYCLGIE-UHFFFAOYSA-N |
| SMILES | CCCC1=NN(C(=C1[N+](=O)[O-])C(=O)O)C |
Computed by PubChem (NCBI)