CAS 1820570-16-8 is the registry number for Methyl 1-((3R,4S)-4-hydroxytetrahydrofuran-3-yl)-1H-1,2,3-triazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazole-4-carboxylate (CAS 1820570-16-8) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: methyl 1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazole-4-carboxylate. InChIKey: XVKRKAHAGSIFFG-RNFRBKRXSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | methyl 1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazole-4-carboxylate |
| InChIKey | XVKRKAHAGSIFFG-RNFRBKRXSA-N |
| SMILES | COC(=O)C1=CN(N=N1)[C@@H]2COC[C@H]2O |
Computed by PubChem (NCBI)