cas: 481065-92-3 — see every product listed under this CAS number, including other names
1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid 97% (CAS 481065-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151529-100mg |
| cas | 481065-92-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A151529 |
1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 481065-92-3) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: QMIUBFUPVMQMRE-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | QMIUBFUPVMQMRE-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)