cas: 119083-00-0 — see every product listed under this CAS number, including other names
1-Methyl-5-(trifluoromethyl)pyrazole-4-carboxylic Acid, >98.0%(GC)(T) (CAS 119083-00-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2753-200MG |
| cas | 119083-00-0 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 206.86 Pln | |
| TCI | 1g | 605.15 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 119083-00-0) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: VAKOSNKAXYJZRG-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | VAKOSNKAXYJZRG-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)