1-Naphthalimide, 97%
cas: 2243-81-4 — see every product listed under this CAS number, including other names
1-Naphthalimide, 97% (CAS 2243-81-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018890-1G |
| cas | 2243-81-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 450.90 Pln | |
| Fluorochem | 25g | 846.59 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Naphthalene-1-carboxamide (CAS 2243-81-4) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: naphthalene-1-carboxamide. InChIKey: RMHJJUOPOWPRBP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | naphthalene-1-carboxamide |
| InChIKey | RMHJJUOPOWPRBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)N |
Computed by PubChem (NCBI)