cas: 87014-28-6 — see every product listed under this CAS number, including other names
1-Nitro-2-(2,2,2-trifluoroethoxy)benzene, 98%, 98% (CAS 87014-28-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115GQR-100mg |
| cas | 87014-28-6 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 25g | 1528.40 Pln | |
| Chemat | 100g | 5920.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-nitro-2-(2,2,2-trifluoroethoxy)benzene (CAS 87014-28-6) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 1-nitro-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: DLJUDLUVULSXDS-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 1-nitro-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | DLJUDLUVULSXDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)