cas: 62149-35-3 — see every product listed under this CAS number, including other names
1-Nitro-4-(2,2,2-trifluoroethoxy)benzene, 98% (CAS 62149-35-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | AN-3239-10g |
| cas | 62149-35-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 100mg | 154.63 Pln | |
| AmBeed | 1g | 356.44 Pln | |
| AmBeed | 250mg | 213.22 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 10g | 909.07 Pln | |
| Fluorochem | 25g | 1924.34 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 919.49 Pln | |
| Fluorochem | 10g | 1346.42 Pln | |
| Fluorochem | 25g | 2611.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-nitro-4-(2,2,2-trifluoroethoxy)benzene (CAS 62149-35-3) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 1-nitro-4-(2,2,2-trifluoroethoxy)benzene. InChIKey: PPYNEIXRXPMHLF-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 1-nitro-4-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | PPYNEIXRXPMHLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)