1-Oxa-6-azaspiro[3.3]heptane oxalate, 95%
cas: 1427358-60-8 — see every product listed under this CAS number, including other names
1-Oxa-6-azaspiro[3.3]heptane oxalate, 95% (CAS 1427358-60-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A436136-100mg |
| cas | 1427358-60-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 581.75 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1772.12 Pln | |
| Ambeed | 5g | 5382.19 Pln | |
| Ambeed | 10g | 9181.38 Pln | |
| BLDpharm | 100mg | 625.36 Pln | |
| BLDpharm | 250mg | 808.63 Pln | |
| BLDpharm | 1g | 1908.24 Pln | |
| BLDpharm | 5g | 5801.32 Pln | |
| BLDpharm | 10g | 9894.32 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-oxa-6-azaspiro[3.3]heptane;oxalic acid (CAS 1427358-60-8) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: 1-oxa-6-azaspiro[3.3]heptane;oxalic acid. InChIKey: HEQQLMIYMDQAPT-UHFFFAOYSA-N.
| Molecular formula | C7H11NO5 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-oxa-6-azaspiro[3.3]heptane;oxalic acid |
| InChIKey | HEQQLMIYMDQAPT-UHFFFAOYSA-N |
| SMILES | C1COC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)