CAS 19146-55-5 appears in our catalog under these names: N-Acetyl-D-glutamic Acid, >95% (HPLC), Ac–D–Glu–OH, N-Acetyl-D-glutamic acid, Ac-D-Glu-OH 98%, Ac-D-Glu-OH, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100g, 10g, 25g, 50g, 500g, 10 g, 100 g.
(2R)-2-acetamidopentanedioic acid (CAS 19146-55-5) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: (2R)-2-acetamidopentanedioic acid. InChIKey: RFMMMVDNIPUKGG-RXMQYKEDSA-N.
| Molecular formula | C7H11NO5 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (2R)-2-acetamidopentanedioic acid |
| InChIKey | RFMMMVDNIPUKGG-RXMQYKEDSA-N |
| SMILES | CC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)