CAS 4910-47-8 appears in our catalog under these names: Ac-asp-ome, 98%, Ac–Asp–OMe, AC-ASP-OME, 97%, 97%, Acetyl-L-aspartic acid a-methyl ester, 97%, Ac-Asp-OMe, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 50mg.
(3S)-3-acetamido-4-methoxy-4-oxobutanoic acid (CAS 4910-47-8) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: (3S)-3-acetamido-4-methoxy-4-oxobutanoic acid. InChIKey: KCNZNZZVMFPESV-YFKPBYRVSA-N.
| Molecular formula | C7H11NO5 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (3S)-3-acetamido-4-methoxy-4-oxobutanoic acid |
| InChIKey | KCNZNZZVMFPESV-YFKPBYRVSA-N |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)