Products 1427358-60-8
CAS 1427358-60-8 appears in our catalog under these names: 1-Oxa-6-azaspiro[3.3]heptane oxalate, 98%, 1-Oxa-6-azaspiro[3.3]heptane oxalate, 95%, 1-Oxa-6-azaspiro[3.3]heptane Oxalate, 97%, 1-Oxa-6-azaspiro[3.3]heptane oxalic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
1-oxa-6-azaspiro[3.3]heptane;oxalic acid (CAS 1427358-60-8) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: 1-oxa-6-azaspiro[3.3]heptane;oxalic acid. InChIKey: HEQQLMIYMDQAPT-UHFFFAOYSA-N.
| Molecular formula | C7H11NO5 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-oxa-6-azaspiro[3.3]heptane;oxalic acid |
| InChIKey | HEQQLMIYMDQAPT-UHFFFAOYSA-N |
| SMILES | C1COC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)