Products 78339-55-6

CAS 78339-55-6 is the registry number for 4-((1-Carboxyethyl)amino)-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(1-carboxyethylamino)-4-oxobutanoic acid (CAS 78339-55-6) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: 4-(1-carboxyethylamino)-4-oxobutanoic acid. InChIKey: KAOMVEQNJVSESC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO5
Molecular weight189.17 g/mol
IUPAC name4-(1-carboxyethylamino)-4-oxobutanoic acid
InChIKeyKAOMVEQNJVSESC-UHFFFAOYSA-N
SMILESCC(C(=O)O)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)