Products 1434126-91-6
CAS 1434126-91-6 is the registry number for 2-Oxa-5-azabicyclo[2.2.1]heptane oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane;oxalic acid (CAS 1434126-91-6) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane;oxalic acid. InChIKey: YYPTYBVAKAFTBB-FHAQVOQBSA-N.
| Molecular formula | C7H11NO5 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane;oxalic acid |
| InChIKey | YYPTYBVAKAFTBB-FHAQVOQBSA-N |
| SMILES | C1[C@H]2CN[C@@H]1CO2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)