cas: 212374-18-0 — see every product listed under this CAS number, including other names
1-Oxo-1,2-dihydroisoquinoline-5-carboxylic acid, 97% (CAS 212374-18-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235390-100MG |
| cas | 212374-18-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 560.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-oxo-2H-isoquinoline-5-carboxylic acid (CAS 212374-18-0) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 1-oxo-2H-isoquinoline-5-carboxylic acid. InChIKey: MLQUDHWCGDWPDJ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-oxo-2H-isoquinoline-5-carboxylic acid |
| InChIKey | MLQUDHWCGDWPDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CNC2=O)C(=C1)C(=O)O |
Computed by PubChem (NCBI)