CAS 386207-63-2 appears in our catalog under these names: 4-Oxo-1,4-dihydro-quinoline-8-carboxylic acid, 95%, 4-Hydroxy-quinoline-8-carboxylic acid, 95%, 4-Hydroxyquinoline-8-carboxylic acid, 98+%, 4-HYDROXYQUINOLINE-8-CARBOXYLIC ACID, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-oxo-1H-quinoline-8-carboxylic acid (CAS 386207-63-2) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 4-oxo-1H-quinoline-8-carboxylic acid. InChIKey: HBZGTHSCSFZZGL-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-oxo-1H-quinoline-8-carboxylic acid |
| InChIKey | HBZGTHSCSFZZGL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NC=CC2=O |
Computed by PubChem (NCBI)