cas: 56461-20-2 — see every product listed under this CAS number, including other names
1-Oxo-2,3-dihydro-1H-indene-4-carboxylic acid, ≥95%, ≥95% (CAS 56461-20-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EDDN-250mg |
| cas | 56461-20-2 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1245.20 Pln | |
| Chemat | 500mg | 2190.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-oxo-2,3-dihydroindene-4-carboxylic acid (CAS 56461-20-2) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 1-oxo-2,3-dihydroindene-4-carboxylic acid. InChIKey: UEZFIXMZVFIHGO-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-oxo-2,3-dihydroindene-4-carboxylic acid |
| InChIKey | UEZFIXMZVFIHGO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)