cas: 850021-37-3 — see every product listed under this CAS number, including other names
1-Oxo-3-phenyl-3,4-dihydro-1H-2-benzopyran-6-carboxylic acid, 95% (CAS 850021-37-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A845688-10g |
| cas | 850021-37-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 29013.46 Pln | |
| AmBeed | 5g | 19534.90 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxylic acid (CAS 850021-37-3) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxylic acid. InChIKey: AFKBLZJLXZXBDM-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxylic acid |
| InChIKey | AFKBLZJLXZXBDM-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)C2=C1C=C(C=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)