Products 296274-02-7

CAS 296274-02-7 is the registry number for 5-[(2-Naphthyloxy)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-(naphthalen-2-yloxymethyl)furan-2-carboxylic acid (CAS 296274-02-7) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 5-(naphthalen-2-yloxymethyl)furan-2-carboxylic acid. InChIKey: TZZKTURKDLWLQM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O4
Molecular weight268.26 g/mol
IUPAC name5-(naphthalen-2-yloxymethyl)furan-2-carboxylic acid
InChIKeyTZZKTURKDLWLQM-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)OCC3=CC=C(O3)C(=O)O

Computed by PubChem (NCBI)