cas: 2622-60-8 — see every product listed under this CAS number, including other names
1-Phenyl-1H-benzo[d]imidazole, 98%, 98% (CAS 2622-60-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SCB-25mg |
| cas | 2622-60-8 |
| size | 25mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 136.40 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 702.80 Pln | |
| Chemat | 5g | 2334.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-phenylbenzimidazole (CAS 2622-60-8) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 1-phenylbenzimidazole. InChIKey: XNCMQRWVMWLODV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-phenylbenzimidazole |
| InChIKey | XNCMQRWVMWLODV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=CC=CC=C32 |
Computed by PubChem (NCBI)