CAS 185316-58-9 appears in our catalog under these names: 5-Phenyl-1h-indazole, 98%, 5-Phenyl-1H-indazole, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
5-phenyl-1H-indazole (CAS 185316-58-9) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 5-phenyl-1H-indazole. InChIKey: JQHTYMOOIFVIJV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-phenyl-1H-indazole |
| InChIKey | JQHTYMOOIFVIJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)NN=C3 |
Computed by PubChem (NCBI)