CAS 342613-84-7 is the registry number for 3'-Amino-biphenyl-2-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(3-aminophenyl)benzonitrile (CAS 342613-84-7) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(3-aminophenyl)benzonitrile. InChIKey: GGJLSLOHVMYBDP-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(3-aminophenyl)benzonitrile |
| InChIKey | GGJLSLOHVMYBDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)